About 2-(3-methoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine
2-(3-methoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine (PubChem CID 53213525) has the molecular formula C18H22N6O
and a molecular weight of 338.42 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine.
Molecular Properties
| Compound Name | 2-(3-methoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine |
| PubChem CID | 53213525 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-(3-methoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine |
| SMILES | COc1cccc(-n2nc3c(N4CCNCC4)nnc(C)c3c2C)c1 |
| InChI | InChI=1S/C18H22N6O/c1-12-16-13(2)24(14-5-4-6-15(11-14)25-3)22-17(16)18(21-20-12)23-9-7-19-8-10-23/h4-6,11,19H,7-10H2,1-3H3 |
| InChIKey | NMGMIEAZWLIFEZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(3-methoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine?
The IUPAC name of 2-(3-methoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine (CID 53213525) is 2-(3-methoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine.
What is the SMILES notation for 2-(3-methoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine?
The canonical SMILES for 2-(3-methoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine is COc1cccc(-n2nc3c(N4CCNCC4)nnc(C)c3c2C)c1.
What is the InChIKey of 2-(3-methoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine?
The InChIKey is NMGMIEAZWLIFEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N6O/c1-12-16-13(2)24(14-5-4-6-15(11-14)25-3)22-17(16)18(21-20-12)23-9-7-19-8-10-23/h4-6,11,19H,7-10H2,1-3H3.
What are the key properties of 2-(3-methoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine?
2-(3-methoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine has a molecular weight of 338.42 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxyphenyl)-3,4-dimethyl-7-piperazin-1-ylpyrazolo[3,4-d]pyridazine is sourced from PubChem (CID 53213525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).