About 5'-propan-2-ylspiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline]
5'-propan-2-ylspiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline] (PubChem CID 53213553) has the molecular formula C18H23N3
and a molecular weight of 281.40 g/mol. Its IUPAC name is 5'-propan-2-ylspiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline].
Molecular Properties
| Compound Name | 5'-propan-2-ylspiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline] |
| PubChem CID | 53213553 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 5'-propan-2-ylspiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline] |
| SMILES | CC(C)N1c2ccccc2-n2cccc2C12CCNCC2 |
| InChI | InChI=1S/C18H23N3/c1-14(2)21-16-7-4-3-6-15(16)20-13-5-8-17(20)18(21)9-11-19-12-10-18/h3-8,13-14,19H,9-12H2,1-2H3 |
| InChIKey | RWBWEGCAUYFXRR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5'-propan-2-ylspiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5'-propan-2-ylspiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline]?
The IUPAC name of 5'-propan-2-ylspiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline] (CID 53213553) is 5'-propan-2-ylspiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline].
What is the SMILES notation for 5'-propan-2-ylspiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline]?
The canonical SMILES for 5'-propan-2-ylspiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline] is CC(C)N1c2ccccc2-n2cccc2C12CCNCC2.
What is the InChIKey of 5'-propan-2-ylspiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline]?
The InChIKey is RWBWEGCAUYFXRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3/c1-14(2)21-16-7-4-3-6-15(16)20-13-5-8-17(20)18(21)9-11-19-12-10-18/h3-8,13-14,19H,9-12H2,1-2H3.
What are the key properties of 5'-propan-2-ylspiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline]?
5'-propan-2-ylspiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline] has a molecular weight of 281.40 g/mol, XLogP of 3.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5'-propan-2-ylspiro[piperidine-4,4'-pyrrolo[1,2-a]quinoxaline] is sourced from PubChem (CID 53213553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).