C7H8F5NO2 — CID 532139
2,2,3,3,3-pentafluoro-1-morpholin-4-ylpropan-1-one (PubChem CID 532139) has the molecular formula C7H8F5NO2 and a molecular weight of 233.14 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-morpholin-4-ylpropan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 532139 |
| Molecular Formula | C7H8F5NO2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-morpholin-4-ylpropan-1-one |
| SMILES | O=C(N1CCOCC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8F5NO2/c8-6(9,7(10,11)12)5(14)13-1-3-15-4-2-13/h1-4H2 |
| InChIKey | MCMFICISKZFNCY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|