About 5-methyl-3H-furo[2,3-d]pyrimidin-4-one
5-methyl-3H-furo[2,3-d]pyrimidin-4-one (PubChem CID 53213978) has the molecular formula C7H6N2O2
and a molecular weight of 150.14 g/mol. Its IUPAC name is 5-methyl-3H-furo[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-methyl-3H-furo[2,3-d]pyrimidin-4-one |
| PubChem CID | 53213978 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 5-methyl-3H-furo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1coc2nc[nH]c(=O)c12 |
| InChI | InChI=1S/C7H6N2O2/c1-4-2-11-7-5(4)6(10)8-3-9-7/h2-3H,1H3,(H,8,9,10) |
| InChIKey | LZZBYXTYRBPCJN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-3H-furo[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3H-furo[2,3-d]pyrimidin-4-one?
The IUPAC name of 5-methyl-3H-furo[2,3-d]pyrimidin-4-one (CID 53213978) is 5-methyl-3H-furo[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 5-methyl-3H-furo[2,3-d]pyrimidin-4-one?
The canonical SMILES for 5-methyl-3H-furo[2,3-d]pyrimidin-4-one is Cc1coc2nc[nH]c(=O)c12.
What is the InChIKey of 5-methyl-3H-furo[2,3-d]pyrimidin-4-one?
The InChIKey is LZZBYXTYRBPCJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2/c1-4-2-11-7-5(4)6(10)8-3-9-7/h2-3H,1H3,(H,8,9,10).
What are the key properties of 5-methyl-3H-furo[2,3-d]pyrimidin-4-one?
5-methyl-3H-furo[2,3-d]pyrimidin-4-one has a molecular weight of 150.14 g/mol, XLogP of 0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3H-furo[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 53213978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).