C7H15N5S — CID 53215298
9-methyl-1,2,4,5,9-pentazaspiro[5.5]undecane-3-thione (PubChem CID 53215298) has the molecular formula C7H15N5S and a molecular weight of 201.30 g/mol. Its IUPAC name is 9-methyl-1,2,4,5,9-pentazaspiro[5.5]undecane-3-thione.
| Compound Name | 9-methyl-1,2,4,5,9-pentazaspiro[5.5]undecane-3-thione |
|---|---|
| PubChem CID | 53215298 |
| Molecular Formula | C7H15N5S |
| Molecular Weight | 201.30 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 9-methyl-1,2,4,5,9-pentazaspiro[5.5]undecane-3-thione |
| SMILES | CN1CCC2(CC1)NNC(=S)NN2 |
| InChI | InChI=1S/C7H15N5S/c1-12-4-2-7(3-5-12)10-8-6(13)9-11-7/h10-11H,2-5H2,1H3,(H2,8,9,13) |
| InChIKey | KFRKBNSPBMHVNB-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.30 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_F(6)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|