C9H10N4S — CID 53215377
6-(4-methylphenyl)-2,4-dihydro-1H-1,2,4,5-tetrazine-3-thione (PubChem CID 53215377) has the molecular formula C9H10N4S and a molecular weight of 206.27 g/mol. Its IUPAC name is 6-(4-methylphenyl)-2,4-dihydro-1H-1,2,4,5-tetrazine-3-thione.
| Compound Name | 6-(4-methylphenyl)-2,4-dihydro-1H-1,2,4,5-tetrazine-3-thione |
|---|---|
| PubChem CID | 53215377 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 6-(4-methylphenyl)-2,4-dihydro-1H-1,2,4,5-tetrazine-3-thione |
| SMILES | Cc1ccc(C2=NNC(=S)NN2)cc1 |
| InChI | InChI=1S/C9H10N4S/c1-6-2-4-7(5-3-6)8-10-12-9(14)13-11-8/h2-5H,1H3,(H,10,11)(H2,12,13,14) |
| InChIKey | JWSMTORMAXKJEB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|