C4H9N5 — CID 53215388
6-ethyl-1,4-dihydro-1,2,4,5-tetrazin-3-amine (PubChem CID 53215388) has the molecular formula C4H9N5 and a molecular weight of 127.15 g/mol. Its IUPAC name is 6-ethyl-1,4-dihydro-1,2,4,5-tetrazin-3-amine.
| Compound Name | 6-ethyl-1,4-dihydro-1,2,4,5-tetrazin-3-amine |
|---|---|
| PubChem CID | 53215388 |
| Molecular Formula | C4H9N5 |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.09 |
| IUPAC Name | 6-ethyl-1,4-dihydro-1,2,4,5-tetrazin-3-amine |
| SMILES | CCC1=NNC(N)=NN1 |
| InChI | InChI=1S/C4H9N5/c1-2-3-6-8-4(5)9-7-3/h2H2,1H3,(H,6,7)(H3,5,8,9) |
| InChIKey | BNWCCXCEVHDUCG-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |