C15H14N2O5 — CID 532160
N-(2,5-dimethoxyphenyl)-4-nitrobenzamide (PubChem CID 532160) has the molecular formula C15H14N2O5 and a molecular weight of 302.29 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-4-nitrobenzamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 532160 |
| Molecular Formula | C15H14N2O5 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-4-nitrobenzamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C15H14N2O5/c1-21-12-7-8-14(22-2)13(9-12)16-15(18)10-3-5-11(6-4-10)17(19)20/h3-9H,1-2H3,(H,16,18) |
| InChIKey | HUMYECVYADBLCY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|