About 3-(3-bromo-1,2-oxazol-5-yl)propanamide
3-(3-bromo-1,2-oxazol-5-yl)propanamide (PubChem CID 53216203) has the molecular formula C6H7BrN2O2
and a molecular weight of 219.04 g/mol. Its IUPAC name is 3-(3-bromo-1,2-oxazol-5-yl)propanamide.
Molecular Properties
| Compound Name | 3-(3-bromo-1,2-oxazol-5-yl)propanamide |
| PubChem CID | 53216203 |
| Molecular Formula | C6H7BrN2O2 |
| Molecular Weight | 219.04 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | 3-(3-bromo-1,2-oxazol-5-yl)propanamide |
| SMILES | NC(=O)CCc1cc(Br)no1 |
| InChI | InChI=1S/C6H7BrN2O2/c7-5-3-4(11-9-5)1-2-6(8)10/h3H,1-2H2,(H2,8,10) |
| InChIKey | GCVBGZNEHSVFDZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.04 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-bromo-1,2-oxazol-5-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromo-1,2-oxazol-5-yl)propanamide?
The IUPAC name of 3-(3-bromo-1,2-oxazol-5-yl)propanamide (CID 53216203) is 3-(3-bromo-1,2-oxazol-5-yl)propanamide.
What is the SMILES notation for 3-(3-bromo-1,2-oxazol-5-yl)propanamide?
The canonical SMILES for 3-(3-bromo-1,2-oxazol-5-yl)propanamide is NC(=O)CCc1cc(Br)no1.
What is the InChIKey of 3-(3-bromo-1,2-oxazol-5-yl)propanamide?
The InChIKey is GCVBGZNEHSVFDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrN2O2/c7-5-3-4(11-9-5)1-2-6(8)10/h3H,1-2H2,(H2,8,10).
What are the key properties of 3-(3-bromo-1,2-oxazol-5-yl)propanamide?
3-(3-bromo-1,2-oxazol-5-yl)propanamide has a molecular weight of 219.04 g/mol, XLogP of 0.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromo-1,2-oxazol-5-yl)propanamide is sourced from PubChem (CID 53216203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).