(1,5-dimethylpyrazol-4-yl)boronic acid

C5H9BN2O2 — CID 53216597

IUPAC(1,5-dimethylpyrazol-4-yl)boronic acid
SMILESCc1c(B(O)O)cnn1C
InChIInChI=1S/C5H9BN2O2/c1-4-5(6(9)10)3-7-8(4)2/h3,9-10H,1-2H3
InChIKeyNAYVNBPKYJFKQA-UHFFFAOYSA-N
MW139.95 g/mol
LogP-1.59
Rot. Bonds1

About (1,5-dimethylpyrazol-4-yl)boronic acid

(1,5-dimethylpyrazol-4-yl)boronic acid (PubChem CID 53216597) has the molecular formula C5H9BN2O2 and a molecular weight of 139.95 g/mol. Its IUPAC name is (1,5-dimethylpyrazol-4-yl)boronic acid.

Molecular Properties

Compound Name(1,5-dimethylpyrazol-4-yl)boronic acid
PubChem CID53216597
Molecular FormulaC5H9BN2O2
Molecular Weight139.95 g/mol
Exact Mass140.08
IUPAC Name(1,5-dimethylpyrazol-4-yl)boronic acid
SMILESCc1c(B(O)O)cnn1C
InChIInChI=1S/C5H9BN2O2/c1-4-5(6(9)10)3-7-8(4)2/h3,9-10H,1-2H3
InChIKeyNAYVNBPKYJFKQA-UHFFFAOYSA-N
XLogP-1.59
TPSA58.28 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500139.95
LogP ≤ 5-1.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (1,5-dimethylpyrazol-4-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,5-dimethylpyrazol-4-yl)boronic acid?
The IUPAC name of (1,5-dimethylpyrazol-4-yl)boronic acid (CID 53216597) is (1,5-dimethylpyrazol-4-yl)boronic acid.
What is the SMILES notation for (1,5-dimethylpyrazol-4-yl)boronic acid?
The canonical SMILES for (1,5-dimethylpyrazol-4-yl)boronic acid is Cc1c(B(O)O)cnn1C.
What is the InChIKey of (1,5-dimethylpyrazol-4-yl)boronic acid?
The InChIKey is NAYVNBPKYJFKQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9BN2O2/c1-4-5(6(9)10)3-7-8(4)2/h3,9-10H,1-2H3.
What are the key properties of (1,5-dimethylpyrazol-4-yl)boronic acid?
(1,5-dimethylpyrazol-4-yl)boronic acid has a molecular weight of 139.95 g/mol, XLogP of -1.59, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,5-dimethylpyrazol-4-yl)boronic acid is sourced from PubChem (CID 53216597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).