C32H46O13 — CID 5321674
[(1R,2R,3R,4R,5S,7S,8S,9R,10R,13S)-5,7,9,10,13-pentaacetyloxy-2-hydroxy-8,12,15,15-tetramethyl-4-tricyclo[9.3.1.03,8]pentadec-11-enyl]methyl acetate (PubChem CID 5321674) has the molecular formula C32H46O13 and a molecular weight of 638.71 g/mol. Its IUPAC name is [(1R,2R,3R,4R,5S,7S,8S,9R,10R,13S)-5,7,9,10,13-pentaacetyloxy-2-hydroxy-8,12,15,15-tetramethyl-4-tricyclo[9.3.1.03,8]pentadec-11-enyl]methyl acetate.
| Compound Name | [(1R,2R,3R,4R,5S,7S,8S,9R,10R,13S)-5,7,9,10,13-pentaacetyloxy-2-hydroxy-8,12,15,15-tetramethyl-4-tricyclo[9.3.1.03,8]pentadec-11-enyl]methyl acetate |
|---|---|
| PubChem CID | 5321674 |
| Molecular Formula | C32H46O13 |
| Molecular Weight | 638.71 g/mol |
| Exact Mass | 638.29 |
| IUPAC Name | [(1R,2R,3R,4R,5S,7S,8S,9R,10R,13S)-5,7,9,10,13-pentaacetyloxy-2-hydroxy-8,12,15,15-tetramethyl-4-tricyclo[9.3.1.03,8]pentadec-11-enyl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1[C@H]2[C@H](O)[C@@H]3C[C@H](OC(C)=O)C(C)=C([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@]2(C)[C@@H](OC(C)=O)C[C@@H]1OC(C)=O)C3(C)C |
| InChI | InChI=1S/C32H46O13/c1-14-23(41-16(3)34)11-22-28(39)27-21(13-40-15(2)33)24(42-17(4)35)12-25(43-18(5)36)32(27,10)30(45-20(7)38)29(44-19(6)37)26(14)31(22,8)9/h21-25,27-30,39H,11-13H2,1-10H3/t21-,22+,23+,24+,25+,27+,28-,29-,30+,32-/m1/s1 |
| InChIKey | LXSXHYVFNXASJF-PNQAOHGVSA-N |
| XLogP | 2.59 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.71 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|