C11H23BClNO2 — CID 53216775
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine;hydrochloride (PubChem CID 53216775) has the molecular formula C11H23BClNO2 and a molecular weight of 247.57 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine;hydrochloride.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 53216775 |
| Molecular Formula | C11H23BClNO2 |
| Molecular Weight | 247.57 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine;hydrochloride |
| SMILES | CC1(C)OB(C2CCNCC2)OC1(C)C.Cl |
| InChI | InChI=1S/C11H22BNO2.ClH/c1-10(2)11(3,4)15-12(14-10)9-5-7-13-8-6-9;/h9,13H,5-8H2,1-4H3;1H |
| InChIKey | DJEBJGUAIJWKGA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|