C14H17BBrNO2 — CID 53216789
6-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (PubChem CID 53216789) has the molecular formula C14H17BBrNO2 and a molecular weight of 322.01 g/mol. Its IUPAC name is 6-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole.
| Compound Name | 6-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
|---|---|
| PubChem CID | 53216789 |
| Molecular Formula | C14H17BBrNO2 |
| Molecular Weight | 322.01 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 6-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| SMILES | CC1(C)OB(c2cc3ccc(Br)cc3[nH]2)OC1(C)C |
| InChI | InChI=1S/C14H17BBrNO2/c1-13(2)14(3,4)19-15(18-13)12-7-9-5-6-10(16)8-11(9)17-12/h5-8,17H,1-4H3 |
| InChIKey | BTDQQZKRCOKCTM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.01 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|