C16H20BNO4 — CID 53217131
methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylate (PubChem CID 53217131) has the molecular formula C16H20BNO4 and a molecular weight of 301.15 g/mol. Its IUPAC name is methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylate.
| Compound Name | methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 53217131 |
| Molecular Formula | C16H20BNO4 |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | methyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2cc(B3OC(C)(C)C(C)(C)O3)[nH]c2c1 |
| InChI | InChI=1S/C16H20BNO4/c1-15(2)16(3,4)22-17(21-15)13-9-10-6-7-11(14(19)20-5)8-12(10)18-13/h6-9,18H,1-5H3 |
| InChIKey | MOQAIXOQKOUHGG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|