C33H48O10 — CID 5321770
[(1S,2S,3R,5S,8R,9R,10R,14S)-2,5,9,10-tetraacetyloxy-8,12,15,15-tetramethyl-4-methylidene-14-tricyclo[9.3.1.03,8]pentadec-11-enyl] 2-methylbutanoate (PubChem CID 5321770) has the molecular formula C33H48O10 and a molecular weight of 604.74 g/mol. Its IUPAC name is [(1S,2S,3R,5S,8R,9R,10R,14S)-2,5,9,10-tetraacetyloxy-8,12,15,15-tetramethyl-4-methylidene-14-tricyclo[9.3.1.03,8]pentadec-11-enyl] 2-methylbutanoate.
| Compound Name | [(1S,2S,3R,5S,8R,9R,10R,14S)-2,5,9,10-tetraacetyloxy-8,12,15,15-tetramethyl-4-methylidene-14-tricyclo[9.3.1.03,8]pentadec-11-enyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 5321770 |
| Molecular Formula | C33H48O10 |
| Molecular Weight | 604.74 g/mol |
| Exact Mass | 604.32 |
| IUPAC Name | [(1S,2S,3R,5S,8R,9R,10R,14S)-2,5,9,10-tetraacetyloxy-8,12,15,15-tetramethyl-4-methylidene-14-tricyclo[9.3.1.03,8]pentadec-11-enyl] 2-methylbutanoate |
| SMILES | C=C1[C@@H](OC(C)=O)CC[C@@]2(C)[C@@H](OC(C)=O)[C@H](OC(C)=O)C3=C(C)C[C@H](OC(=O)C(C)CC)[C@@H]([C@@H](OC(C)=O)[C@H]12)C3(C)C |
| InChI | InChI=1S/C33H48O10/c1-12-16(2)31(38)43-24-15-17(3)25-29(41-21(7)36)30(42-22(8)37)33(11)14-13-23(39-19(5)34)18(4)26(33)28(40-20(6)35)27(24)32(25,9)10/h16,23-24,26-30H,4,12-15H2,1-3,5-11H3/t16?,23-,24-,26-,27-,28-,29+,30-,33+/m0/s1 |
| InChIKey | NDUFGVRVJKHNKE-CFBDZCFDSA-N |
| XLogP | 5.02 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.74 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|