About 3-(2,4-dimethylphenyl)phenol
3-(2,4-dimethylphenyl)phenol (PubChem CID 53218508) has the molecular formula C14H14O
and a molecular weight of 198.26 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)phenol.
Molecular Properties
| Compound Name | 3-(2,4-dimethylphenyl)phenol |
| PubChem CID | 53218508 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 3-(2,4-dimethylphenyl)phenol |
| SMILES | Cc1ccc(-c2cccc(O)c2)c(C)c1 |
| InChI | InChI=1S/C14H14O/c1-10-6-7-14(11(2)8-10)12-4-3-5-13(15)9-12/h3-9,15H,1-2H3 |
| InChIKey | JSYFFGLOVKIZJM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2,4-dimethylphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dimethylphenyl)phenol?
The IUPAC name of 3-(2,4-dimethylphenyl)phenol (CID 53218508) is 3-(2,4-dimethylphenyl)phenol.
What is the SMILES notation for 3-(2,4-dimethylphenyl)phenol?
The canonical SMILES for 3-(2,4-dimethylphenyl)phenol is Cc1ccc(-c2cccc(O)c2)c(C)c1.
What is the InChIKey of 3-(2,4-dimethylphenyl)phenol?
The InChIKey is JSYFFGLOVKIZJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O/c1-10-6-7-14(11(2)8-10)12-4-3-5-13(15)9-12/h3-9,15H,1-2H3.
What are the key properties of 3-(2,4-dimethylphenyl)phenol?
3-(2,4-dimethylphenyl)phenol has a molecular weight of 198.26 g/mol, XLogP of 3.68, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethylphenyl)phenol is sourced from PubChem (CID 53218508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).