About 1-oxo-1,4-thiazinane-3-carboxylic acid
1-oxo-1,4-thiazinane-3-carboxylic acid (PubChem CID 5321943) has the molecular formula C5H9NO3S
and a molecular weight of 163.20 g/mol. Its IUPAC name is 1-oxo-1,4-thiazinane-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-oxo-1,4-thiazinane-3-carboxylic acid |
| PubChem CID | 5321943 |
| Molecular Formula | C5H9NO3S |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 1-oxo-1,4-thiazinane-3-carboxylic acid |
| SMILES | O=C(O)C1CS(=O)CCN1 |
| InChI | InChI=1S/C5H9NO3S/c7-5(8)4-3-10(9)2-1-6-4/h4,6H,1-3H2,(H,7,8) |
| InChIKey | XXMSBUDHKMHMTJ-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-oxo-1,4-thiazinane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-1,4-thiazinane-3-carboxylic acid?
The IUPAC name of 1-oxo-1,4-thiazinane-3-carboxylic acid (CID 5321943) is 1-oxo-1,4-thiazinane-3-carboxylic acid.
What is the SMILES notation for 1-oxo-1,4-thiazinane-3-carboxylic acid?
The canonical SMILES for 1-oxo-1,4-thiazinane-3-carboxylic acid is O=C(O)C1CS(=O)CCN1.
What is the InChIKey of 1-oxo-1,4-thiazinane-3-carboxylic acid?
The InChIKey is XXMSBUDHKMHMTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3S/c7-5(8)4-3-10(9)2-1-6-4/h4,6H,1-3H2,(H,7,8).
What are the key properties of 1-oxo-1,4-thiazinane-3-carboxylic acid?
1-oxo-1,4-thiazinane-3-carboxylic acid has a molecular weight of 163.20 g/mol, XLogP of -1.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-1,4-thiazinane-3-carboxylic acid is sourced from PubChem (CID 5321943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).