About (4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene
(4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene (PubChem CID 5322111) has the molecular formula C15H24
and a molecular weight of 204.36 g/mol. Its IUPAC name is (4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene.
Molecular Properties
| Compound Name | (4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene |
| PubChem CID | 5322111 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene |
| SMILES | C=C1CC/C=C(/C)CCC2C1CC2(C)C |
| InChI | InChI=1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h6,13-14H,2,5,7-10H2,1,3-4H3/b11-6- |
| InChIKey | NPNUFJAVOOONJE-WDZFZDKYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene?
The IUPAC name of (4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene (CID 5322111) is (4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene.
What is the SMILES notation for (4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene?
The canonical SMILES for (4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene is C=C1CC/C=C(/C)CCC2C1CC2(C)C.
What is the InChIKey of (4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene?
The InChIKey is NPNUFJAVOOONJE-WDZFZDKYSA-N. The full InChI is InChI=1S/C15H24/c1-11-6-5-7-12(2)13-10-15(3,4)14(13)9-8-11/h6,13-14H,2,5,7-10H2,1,3-4H3/b11-6-.
What are the key properties of (4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene?
(4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene has a molecular weight of 204.36 g/mol, XLogP of 4.73, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4,11,11-trimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene is sourced from PubChem (CID 5322111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).