C19H19BrN2O4 — CID 5322371
[4-acetyloxy-6-(4-bromophenyl)-8-methyl-2,3-diazaspiro[4.5]deca-1,3,8-trien-1-yl] acetate (PubChem CID 5322371) has the molecular formula C19H19BrN2O4 and a molecular weight of 419.28 g/mol. Its IUPAC name is [4-acetyloxy-6-(4-bromophenyl)-8-methyl-2,3-diazaspiro[4.5]deca-1,3,8-trien-1-yl] acetate.
| Compound Name | [4-acetyloxy-6-(4-bromophenyl)-8-methyl-2,3-diazaspiro[4.5]deca-1,3,8-trien-1-yl] acetate |
|---|---|
| PubChem CID | 5322371 |
| Molecular Formula | C19H19BrN2O4 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | [4-acetyloxy-6-(4-bromophenyl)-8-methyl-2,3-diazaspiro[4.5]deca-1,3,8-trien-1-yl] acetate |
| SMILES | CC(=O)OC1=NN=C(OC(C)=O)C12CC=C(C)CC2c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H19BrN2O4/c1-11-8-9-19(16(10-11)14-4-6-15(20)7-5-14)17(25-12(2)23)21-22-18(19)26-13(3)24/h4-8,16H,9-10H2,1-3H3 |
| InChIKey | FSYFAIMDFGAXPS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|