C12H9NO5S — CID 53223876
5-(5-methoxycarbonylthiophen-3-yl)-2-oxo-1H-pyridine-3-carboxylic acid (PubChem CID 53223876) has the molecular formula C12H9NO5S and a molecular weight of 279.27 g/mol. Its IUPAC name is 5-(5-methoxycarbonylthiophen-3-yl)-2-oxo-1H-pyridine-3-carboxylic acid.
| Compound Name | 5-(5-methoxycarbonylthiophen-3-yl)-2-oxo-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53223876 |
| Molecular Formula | C12H9NO5S |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 5-(5-methoxycarbonylthiophen-3-yl)-2-oxo-1H-pyridine-3-carboxylic acid |
| SMILES | COC(=O)c1cc(-c2c[nH]c(=O)c(C(=O)O)c2)cs1 |
| InChI | InChI=1S/C12H9NO5S/c1-18-12(17)9-3-7(5-19-9)6-2-8(11(15)16)10(14)13-4-6/h2-5H,1H3,(H,13,14)(H,15,16) |
| InChIKey | ZTIPCHXIXYIXNE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |