C13H8F3NO3 — CID 53223948
6-oxo-5-[2-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxylic acid (PubChem CID 53223948) has the molecular formula C13H8F3NO3 and a molecular weight of 283.20 g/mol. Its IUPAC name is 6-oxo-5-[2-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxylic acid.
| Compound Name | 6-oxo-5-[2-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53223948 |
| Molecular Formula | C13H8F3NO3 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 6-oxo-5-[2-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c(=O)c(-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C13H8F3NO3/c14-13(15,16)10-4-2-1-3-8(10)9-5-7(12(19)20)6-17-11(9)18/h1-6H,(H,17,18)(H,19,20) |
| InChIKey | CZAIZVNXZFQEBP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |