C14H8ClNO6 — CID 53224362
5-(4-carboxy-6-chloro-3-pyridinyl)benzene-1,3-dicarboxylic acid (PubChem CID 53224362) has the molecular formula C14H8ClNO6 and a molecular weight of 321.67 g/mol. Its IUPAC name is 5-(4-carboxy-6-chloro-3-pyridinyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(4-carboxy-6-chloro-3-pyridinyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 53224362 |
| Molecular Formula | C14H8ClNO6 |
| Molecular Weight | 321.67 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 5-(4-carboxy-6-chloro-3-pyridinyl)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(-c2cnc(Cl)cc2C(=O)O)c1 |
| InChI | InChI=1S/C14H8ClNO6/c15-11-4-9(14(21)22)10(5-16-11)6-1-7(12(17)18)3-8(2-6)13(19)20/h1-5H,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | CEZYEFNJWFETGG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.67 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|