C20H26N4O — CID 5322452
(2E,6E)-2,6-bis[(1,3,5-trimethylpyrazol-4-yl)methylidene]cyclohexan-1-one (PubChem CID 5322452) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is (2E,6E)-2,6-bis[(1,3,5-trimethylpyrazol-4-yl)methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2,6-bis[(1,3,5-trimethylpyrazol-4-yl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 5322452 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | (2E,6E)-2,6-bis[(1,3,5-trimethylpyrazol-4-yl)methylidene]cyclohexan-1-one |
| SMILES | Cc1nn(C)c(C)c1/C=C1\CCC/C(=C\c2c(C)nn(C)c2C)C1=O |
| InChI | InChI=1S/C20H26N4O/c1-12-18(14(3)23(5)21-12)10-16-8-7-9-17(20(16)25)11-19-13(2)22-24(6)15(19)4/h10-11H,7-9H2,1-6H3/b16-10+,17-11+ |
| InChIKey | YXGRBFUIUGRTAP-OTYYAQKOSA-N |
| XLogP | 3.61 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|