C13H7F2NO4 — CID 53225943
3-(2,3-difluorophenyl)-5-nitrobenzoic acid (PubChem CID 53225943) has the molecular formula C13H7F2NO4 and a molecular weight of 279.20 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-5-nitrobenzoic acid.
| Compound Name | 3-(2,3-difluorophenyl)-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 53225943 |
| Molecular Formula | C13H7F2NO4 |
| Molecular Weight | 279.20 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 3-(2,3-difluorophenyl)-5-nitrobenzoic acid |
| SMILES | O=C(O)c1cc(-c2cccc(F)c2F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H7F2NO4/c14-11-3-1-2-10(12(11)15)7-4-8(13(17)18)6-9(5-7)16(19)20/h1-6H,(H,17,18) |
| InChIKey | WOBGBFMLQIACQT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|