2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid

C16H14O5 — CID 53227096

IUPAC2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid
SMILESCOC(=O)c1cccc(-c2cccc(C(=O)O)c2OC)c1
InChIInChI=1S/C16H14O5/c1-20-14-12(7-4-8-13(14)15(17)18)10-5-3-6-11(9-10)16(19)21-2/h3-9H,1-2H3,(H,17,18)
InChIKeyFVSJHGVBAMDHRD-UHFFFAOYSA-N
MW286.28 g/mol
LogP2.85
Rot. Bonds4

About 2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid

2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid (PubChem CID 53227096) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid.

Molecular Properties

Compound Name2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid
PubChem CID53227096
Molecular FormulaC16H14O5
Molecular Weight286.28 g/mol
Exact Mass286.08
IUPAC Name2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid
SMILESCOC(=O)c1cccc(-c2cccc(C(=O)O)c2OC)c1
InChIInChI=1S/C16H14O5/c1-20-14-12(7-4-8-13(14)15(17)18)10-5-3-6-11(9-10)16(19)21-2/h3-9H,1-2H3,(H,17,18)
InChIKeyFVSJHGVBAMDHRD-UHFFFAOYSA-N
XLogP2.85
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.28
LogP ≤ 52.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-methoxy-3-(4-methoxycarbonylphenyl)benzoic acid
CID 53227127
3-(2-fluoro-4-methoxycarbonylphenyl)-2-methoxybenzoic acid
CID 53227906
3-[3-(hydroxymethyl)phenyl]-2-methoxybenzoic acid
CID 53225350
3-(3,4-dimethoxyphenyl)-2-methoxybenzoic acid
CID 53227259
2-(3-methoxycarbonylphenyl)-6-methylbenzoic acid
CID 53227079
2-methoxy-3-(4-methoxy-3-methylphenyl)benzoic acid
CID 53226287
3-(4-hydroxyphenyl)-2-methoxybenzoic acid
CID 53224993
3-(4-ethoxycarbonylphenyl)-2-methoxybenzoic acid
CID 53227875
(E)-3-[2-(3-methoxycarbonylphenyl)phenyl]prop-2-enoic acid
CID 170872377
3-(3-carboxyphenyl)-2-methoxybenzenediazonium
CID 170689275
2-methoxy-3-[4-methoxy-3-(trifluoromethyl)phenyl]benzoic acid
CID 53228634
methyl 3-(2-ethynylphenyl)benzoate
CID 175646821

Frequently Asked Questions

What is the IUPAC name of 2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid?
The IUPAC name of 2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid (CID 53227096) is 2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid.
What is the SMILES notation for 2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid?
The canonical SMILES for 2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid is COC(=O)c1cccc(-c2cccc(C(=O)O)c2OC)c1.
What is the InChIKey of 2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid?
The InChIKey is FVSJHGVBAMDHRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O5/c1-20-14-12(7-4-8-13(14)15(17)18)10-5-3-6-11(9-10)16(19)21-2/h3-9H,1-2H3,(H,17,18).
What are the key properties of 2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid?
2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid has a molecular weight of 286.28 g/mol, XLogP of 2.85, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-3-(3-methoxycarbonylphenyl)benzoic acid is sourced from PubChem (CID 53227096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).