C26H30O7 — CID 5322717
(2E,6E)-2,6-bis[(2,3,4-trimethoxyphenyl)methylidene]cyclohexan-1-one (PubChem CID 5322717) has the molecular formula C26H30O7 and a molecular weight of 454.52 g/mol. Its IUPAC name is (2E,6E)-2,6-bis[(2,3,4-trimethoxyphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-2,6-bis[(2,3,4-trimethoxyphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 5322717 |
| Molecular Formula | C26H30O7 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (2E,6E)-2,6-bis[(2,3,4-trimethoxyphenyl)methylidene]cyclohexan-1-one |
| SMILES | COc1ccc(/C=C2\CCC/C(=C\c3ccc(OC)c(OC)c3OC)C2=O)c(OC)c1OC |
| InChI | InChI=1S/C26H30O7/c1-28-20-12-10-18(23(30-3)25(20)32-5)14-16-8-7-9-17(22(16)27)15-19-11-13-21(29-2)26(33-6)24(19)31-4/h10-15H,7-9H2,1-6H3/b16-14+,17-15+ |
| InChIKey | UXPJQPODQDLGGD-YXLFCKQPSA-N |
| XLogP | 4.96 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|