C20H36N2O4 — CID 5322729
methyl 2-[[2-[(4-ethylcyclohexanecarbonyl)amino]-3-methylbutanoyl]amino]-3-methylbutanoate (PubChem CID 5322729) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is methyl 2-[[2-[(4-ethylcyclohexanecarbonyl)amino]-3-methylbutanoyl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[2-[(4-ethylcyclohexanecarbonyl)amino]-3-methylbutanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 5322729 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | methyl 2-[[2-[(4-ethylcyclohexanecarbonyl)amino]-3-methylbutanoyl]amino]-3-methylbutanoate |
| SMILES | CCC1CCC(C(=O)NC(C(=O)NC(C(=O)OC)C(C)C)C(C)C)CC1 |
| InChI | InChI=1S/C20H36N2O4/c1-7-14-8-10-15(11-9-14)18(23)21-16(12(2)3)19(24)22-17(13(4)5)20(25)26-6/h12-17H,7-11H2,1-6H3,(H,21,23)(H,22,24) |
| InChIKey | WWGKVUGGJAPVET-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |