C13H11NO3 — CID 53229197
4-[4-(hydroxymethyl)phenyl]pyridine-3-carboxylic acid (PubChem CID 53229197) has the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)phenyl]pyridine-3-carboxylic acid.
| Compound Name | 4-[4-(hydroxymethyl)phenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 53229197 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4-[4-(hydroxymethyl)phenyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnccc1-c1ccc(CO)cc1 |
| InChI | InChI=1S/C13H11NO3/c15-8-9-1-3-10(4-2-9)11-5-6-14-7-12(11)13(16)17/h1-7,15H,8H2,(H,16,17) |
| InChIKey | RSVKQIJIRSRBKX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |