C14H10N2O2S — CID 53229427
6-amino-3-(1-benzothiophen-2-yl)pyridine-2-carboxylic acid (PubChem CID 53229427) has the molecular formula C14H10N2O2S and a molecular weight of 270.31 g/mol. Its IUPAC name is 6-amino-3-(1-benzothiophen-2-yl)pyridine-2-carboxylic acid.
| Compound Name | 6-amino-3-(1-benzothiophen-2-yl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 53229427 |
| Molecular Formula | C14H10N2O2S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 6-amino-3-(1-benzothiophen-2-yl)pyridine-2-carboxylic acid |
| SMILES | Nc1ccc(-c2cc3ccccc3s2)c(C(=O)O)n1 |
| InChI | InChI=1S/C14H10N2O2S/c15-12-6-5-9(13(16-12)14(17)18)11-7-8-3-1-2-4-10(8)19-11/h1-7H,(H2,15,16)(H,17,18) |
| InChIKey | QMUMEVGJBSYUIV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |