C20H32O3 — CID 53230112
(1S,3R,4S,5S,7S,9S,10R,12R,13R)-5-(hydroxymethyl)-5,9,13-trimethylpentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-3,7-diol (PubChem CID 53230112) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1S,3R,4S,5S,7S,9S,10R,12R,13R)-5-(hydroxymethyl)-5,9,13-trimethylpentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-3,7-diol.
| Compound Name | (1S,3R,4S,5S,7S,9S,10R,12R,13R)-5-(hydroxymethyl)-5,9,13-trimethylpentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-3,7-diol |
|---|---|
| PubChem CID | 53230112 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1S,3R,4S,5S,7S,9S,10R,12R,13R)-5-(hydroxymethyl)-5,9,13-trimethylpentacyclo[11.2.1.01,10.04,9.012,14]hexadecane-3,7-diol |
| SMILES | C[C@]1(CO)C[C@@H](O)C[C@]2(C)[C@@H]1[C@H](O)C[C@@]13CC4[C@@H](C[C@H]12)[C@@]4(C)C3 |
| InChI | InChI=1S/C20H32O3/c1-17(10-21)5-11(22)6-18(2)15-4-12-13-7-20(15,9-19(12,13)3)8-14(23)16(17)18/h11-16,21-23H,4-10H2,1-3H3/t11-,12-,13?,14-,15+,16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | MYZKXRZOEDHLRE-BCBIOZTJSA-N |
| XLogP | 2.58 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |