C21H19ClN2OS — CID 5323043
N-(3-chlorophenyl)-2-(1,2,3,4-tetrahydroacridin-9-ylsulfanyl)acetamide (PubChem CID 5323043) has the molecular formula C21H19ClN2OS and a molecular weight of 382.92 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(1,2,3,4-tetrahydroacridin-9-ylsulfanyl)acetamide.
| Compound Name | N-(3-chlorophenyl)-2-(1,2,3,4-tetrahydroacridin-9-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 5323043 |
| Molecular Formula | C21H19ClN2OS |
| Molecular Weight | 382.92 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-(3-chlorophenyl)-2-(1,2,3,4-tetrahydroacridin-9-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1c2c(nc3ccccc13)CCCC2)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H19ClN2OS/c22-14-6-5-7-15(12-14)23-20(25)13-26-21-16-8-1-3-10-18(16)24-19-11-4-2-9-17(19)21/h1,3,5-8,10,12H,2,4,9,11,13H2,(H,23,25) |
| InChIKey | BTHCOFLFDUONSO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.92 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |