About 1-benzofuran-2-yl-[3,5-bis(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]methanone
1-benzofuran-2-yl-[3,5-bis(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]methanone (PubChem CID 53230865) has the molecular formula C24H16F2N2O2
and a molecular weight of 402.40 g/mol. Its IUPAC name is 1-benzofuran-2-yl-[3,5-bis(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]methanone.
Molecular Properties
| Compound Name | 1-benzofuran-2-yl-[3,5-bis(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]methanone |
| PubChem CID | 53230865 |
| Molecular Formula | C24H16F2N2O2 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 1-benzofuran-2-yl-[3,5-bis(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]methanone |
| SMILES | O=C(c1cc2ccccc2o1)N1N=C(c2ccc(F)cc2)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H16F2N2O2/c25-18-9-5-15(6-10-18)20-14-21(16-7-11-19(26)12-8-16)28(27-20)24(29)23-13-17-3-1-2-4-22(17)30-23/h1-13,21H,14H2 |
| InChIKey | CGABLJPVGRRMSW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzofuran-2-yl-[3,5-bis(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-2-yl-[3,5-bis(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]methanone?
The IUPAC name of 1-benzofuran-2-yl-[3,5-bis(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]methanone (CID 53230865) is 1-benzofuran-2-yl-[3,5-bis(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]methanone.
What is the SMILES notation for 1-benzofuran-2-yl-[3,5-bis(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]methanone?
The canonical SMILES for 1-benzofuran-2-yl-[3,5-bis(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]methanone is O=C(c1cc2ccccc2o1)N1N=C(c2ccc(F)cc2)CC1c1ccc(F)cc1.
What is the InChIKey of 1-benzofuran-2-yl-[3,5-bis(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]methanone?
The InChIKey is CGABLJPVGRRMSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16F2N2O2/c25-18-9-5-15(6-10-18)20-14-21(16-7-11-19(26)12-8-16)28(27-20)24(29)23-13-17-3-1-2-4-22(17)30-23/h1-13,21H,14H2.
What are the key properties of 1-benzofuran-2-yl-[3,5-bis(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]methanone?
1-benzofuran-2-yl-[3,5-bis(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]methanone has a molecular weight of 402.40 g/mol, XLogP of 5.70, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-2-yl-[3,5-bis(4-fluorophenyl)-3,4-dihydropyrazol-2-yl]methanone is sourced from PubChem (CID 53230865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).