C26H30O13 — CID 53230977
2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one (PubChem CID 53230977) has the molecular formula C26H30O13 and a molecular weight of 550.51 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
|---|---|
| PubChem CID | 53230977 |
| Molecular Formula | C26H30O13 |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| SMILES | COc1ccc(-c2oc3c(OC)c(OC)cc(OC)c3c(=O)c2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1OC |
| InChI | InChI=1S/C26H30O13/c1-32-12-7-6-11(8-13(12)33-2)22-25(39-26-21(31)20(30)18(28)16(10-27)37-26)19(29)17-14(34-3)9-15(35-4)23(36-5)24(17)38-22/h6-9,16,18,20-21,26-28,30-31H,10H2,1-5H3/t16-,18-,20+,21-,26+/m1/s1 |
| InChIKey | OKRKUEHVNKANNX-FHIRDOFZSA-N |
| XLogP | 0.68 |
| TPSA | 175.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |