C28H26FNO4S — CID 53231031
ethyl 2-[(2S,3R)-3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-5-phenyl-2,3-dihydropyrrol-2-yl]prop-2-enoate (PubChem CID 53231031) has the molecular formula C28H26FNO4S and a molecular weight of 491.58 g/mol. Its IUPAC name is ethyl 2-[(2S,3R)-3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-5-phenyl-2,3-dihydropyrrol-2-yl]prop-2-enoate.
| Compound Name | ethyl 2-[(2S,3R)-3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-5-phenyl-2,3-dihydropyrrol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 53231031 |
| Molecular Formula | C28H26FNO4S |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | ethyl 2-[(2S,3R)-3-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-5-phenyl-2,3-dihydropyrrol-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)[C@@H]1[C@@H](c2ccc(F)cc2)C=C(c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H26FNO4S/c1-4-34-28(31)20(3)27-25(21-12-14-23(29)15-13-21)18-26(22-8-6-5-7-9-22)30(27)35(32,33)24-16-10-19(2)11-17-24/h5-18,25,27H,3-4H2,1-2H3/t25-,27-/m1/s1 |
| InChIKey | KURXGUQOYLFPCB-XNMGPUDCSA-N |
| XLogP | 5.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|