About (E)-2-benzyl-2-methyl-1,4-diphenylbut-3-en-1-ol
(E)-2-benzyl-2-methyl-1,4-diphenylbut-3-en-1-ol (PubChem CID 53231042) has the molecular formula C24H24O
and a molecular weight of 328.46 g/mol. Its IUPAC name is (E)-2-benzyl-2-methyl-1,4-diphenylbut-3-en-1-ol.
Molecular Properties
| Compound Name | (E)-2-benzyl-2-methyl-1,4-diphenylbut-3-en-1-ol |
| PubChem CID | 53231042 |
| Molecular Formula | C24H24O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (E)-2-benzyl-2-methyl-1,4-diphenylbut-3-en-1-ol |
| SMILES | CC(/C=C/c1ccccc1)(Cc1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C24H24O/c1-24(19-21-13-7-3-8-14-21,18-17-20-11-5-2-6-12-20)23(25)22-15-9-4-10-16-22/h2-18,23,25H,19H2,1H3/b18-17+ |
| InChIKey | ANHMNCZTYNYUJX-ISLYRVAYSA-N |
| XLogP | 5.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-2-benzyl-2-methyl-1,4-diphenylbut-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-benzyl-2-methyl-1,4-diphenylbut-3-en-1-ol?
The IUPAC name of (E)-2-benzyl-2-methyl-1,4-diphenylbut-3-en-1-ol (CID 53231042) is (E)-2-benzyl-2-methyl-1,4-diphenylbut-3-en-1-ol.
What is the SMILES notation for (E)-2-benzyl-2-methyl-1,4-diphenylbut-3-en-1-ol?
The canonical SMILES for (E)-2-benzyl-2-methyl-1,4-diphenylbut-3-en-1-ol is CC(/C=C/c1ccccc1)(Cc1ccccc1)C(O)c1ccccc1.
What is the InChIKey of (E)-2-benzyl-2-methyl-1,4-diphenylbut-3-en-1-ol?
The InChIKey is ANHMNCZTYNYUJX-ISLYRVAYSA-N. The full InChI is InChI=1S/C24H24O/c1-24(19-21-13-7-3-8-14-21,18-17-20-11-5-2-6-12-20)23(25)22-15-9-4-10-16-22/h2-18,23,25H,19H2,1H3/b18-17+.
What are the key properties of (E)-2-benzyl-2-methyl-1,4-diphenylbut-3-en-1-ol?
(E)-2-benzyl-2-methyl-1,4-diphenylbut-3-en-1-ol has a molecular weight of 328.46 g/mol, XLogP of 5.68, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-benzyl-2-methyl-1,4-diphenylbut-3-en-1-ol is sourced from PubChem (CID 53231042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).