About [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] methyl carbonate
[(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] methyl carbonate (PubChem CID 53231196) has the molecular formula C14H26O4Si
and a molecular weight of 286.44 g/mol. Its IUPAC name is [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] methyl carbonate.
Molecular Properties
| Compound Name | [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] methyl carbonate |
| PubChem CID | 53231196 |
| Molecular Formula | C14H26O4Si |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] methyl carbonate |
| SMILES | C=C[C@@H](OC(=O)OC)[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O4Si/c1-9-11(17-13(15)16-6)12(10-2)18-19(7,8)14(3,4)5/h9-12H,1-2H2,3-8H3/t11-,12-/m1/s1 |
| InChIKey | OBGFJCCYRNQVGM-VXGBXAGGSA-N |
| XLogP | 3.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] methyl carbonate?
The IUPAC name of [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] methyl carbonate (CID 53231196) is [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] methyl carbonate.
What is the SMILES notation for [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] methyl carbonate?
The canonical SMILES for [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] methyl carbonate is C=C[C@@H](OC(=O)OC)[C@@H](C=C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] methyl carbonate?
The InChIKey is OBGFJCCYRNQVGM-VXGBXAGGSA-N. The full InChI is InChI=1S/C14H26O4Si/c1-9-11(17-13(15)16-6)12(10-2)18-19(7,8)14(3,4)5/h9-12H,1-2H2,3-8H3/t11-,12-/m1/s1.
What are the key properties of [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] methyl carbonate?
[(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] methyl carbonate has a molecular weight of 286.44 g/mol, XLogP of 3.90, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] methyl carbonate is sourced from PubChem (CID 53231196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).