About tert-butyl [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] carbonate
tert-butyl [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] carbonate (PubChem CID 53231198) has the molecular formula C17H32O4Si
and a molecular weight of 328.53 g/mol. Its IUPAC name is tert-butyl [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] carbonate.
Molecular Properties
| Compound Name | tert-butyl [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] carbonate |
| PubChem CID | 53231198 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | tert-butyl [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] carbonate |
| SMILES | C=C[C@@H](OC(=O)OC(C)(C)C)[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O4Si/c1-11-13(19-15(18)20-16(3,4)5)14(12-2)21-22(9,10)17(6,7)8/h11-14H,1-2H2,3-10H3/t13-,14-/m1/s1 |
| InChIKey | XJMOWIZRMVBLMR-ZIAGYGMSSA-N |
| XLogP | 5.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] carbonate?
The IUPAC name of tert-butyl [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] carbonate (CID 53231198) is tert-butyl [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] carbonate.
What is the SMILES notation for tert-butyl [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] carbonate?
The canonical SMILES for tert-butyl [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] carbonate is C=C[C@@H](OC(=O)OC(C)(C)C)[C@@H](C=C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] carbonate?
The InChIKey is XJMOWIZRMVBLMR-ZIAGYGMSSA-N. The full InChI is InChI=1S/C17H32O4Si/c1-11-13(19-15(18)20-16(3,4)5)14(12-2)21-22(9,10)17(6,7)8/h11-14H,1-2H2,3-10H3/t13-,14-/m1/s1.
What are the key properties of tert-butyl [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] carbonate?
tert-butyl [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] carbonate has a molecular weight of 328.53 g/mol, XLogP of 5.07, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl [(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxyhexa-1,5-dien-3-yl] carbonate is sourced from PubChem (CID 53231198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).