C32H37BBr2 — CID 53231305
3,8-dibromo-11-(2,4,6-tritert-butylphenyl)benzo[b][1]benzoborepine (PubChem CID 53231305) has the molecular formula C32H37BBr2 and a molecular weight of 592.27 g/mol. Its IUPAC name is 3,8-dibromo-11-(2,4,6-tritert-butylphenyl)benzo[b][1]benzoborepine.
| Compound Name | 3,8-dibromo-11-(2,4,6-tritert-butylphenyl)benzo[b][1]benzoborepine |
|---|---|
| PubChem CID | 53231305 |
| Molecular Formula | C32H37BBr2 |
| Molecular Weight | 592.27 g/mol |
| Exact Mass | 590.14 |
| IUPAC Name | 3,8-dibromo-11-(2,4,6-tritert-butylphenyl)benzo[b][1]benzoborepine |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(B2c3ccc(Br)cc3C=Cc3cc(Br)ccc32)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H37BBr2/c1-30(2,3)22-18-25(31(4,5)6)29(26(19-22)32(7,8)9)33-27-14-12-23(34)16-20(27)10-11-21-17-24(35)13-15-28(21)33/h10-19H,1-9H3 |
| InChIKey | IDWAPGPLSPJLCU-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.27 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|