C22H22N2O2 — CID 53231530
14-[2-(diethylamino)ethoxy]-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-8-one (PubChem CID 53231530) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 14-[2-(diethylamino)ethoxy]-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-8-one.
| Compound Name | 14-[2-(diethylamino)ethoxy]-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-8-one |
|---|---|
| PubChem CID | 53231530 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 14-[2-(diethylamino)ethoxy]-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-8-one |
| SMILES | CCN(CC)CCOc1cnc2c3c(cccc13)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C22H22N2O2/c1-3-24(4-2)12-13-26-19-14-23-21-15-8-5-6-9-16(15)22(25)18-11-7-10-17(19)20(18)21/h5-11,14H,3-4,12-13H2,1-2H3 |
| InChIKey | MTEXBKFFTSVXID-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |