C23H25IN2O2 — CID 53231535
diethyl-methyl-[2-[(8-oxo-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-14-yl)oxy]ethyl]azanium iodide (PubChem CID 53231535) has the molecular formula C23H25IN2O2 and a molecular weight of 488.37 g/mol. Its IUPAC name is diethyl-methyl-[2-[(8-oxo-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-14-yl)oxy]ethyl]azanium iodide.
| Compound Name | diethyl-methyl-[2-[(8-oxo-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-14-yl)oxy]ethyl]azanium iodide |
|---|---|
| PubChem CID | 53231535 |
| Molecular Formula | C23H25IN2O2 |
| Molecular Weight | 488.37 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | diethyl-methyl-[2-[(8-oxo-16-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaen-14-yl)oxy]ethyl]azanium iodide |
| SMILES | CC[N+](C)(CC)CCOc1cnc2c3c(cccc13)C(=O)c1ccccc1-2.[I-] |
| InChI | InChI=1S/C23H25N2O2.HI/c1-4-25(3,5-2)13-14-27-20-15-24-22-16-9-6-7-10-17(16)23(26)19-12-8-11-18(20)21(19)22;/h6-12,15H,4-5,13-14H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | DCIJYMBEYUULKO-UHFFFAOYSA-M |
| XLogP | 1.32 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|