C30H37ClN2O2 — CID 53231551
[4-[[benzyl(methyl)amino]methyl]phenyl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone;hydrochloride (PubChem CID 53231551) has the molecular formula C30H37ClN2O2 and a molecular weight of 493.09 g/mol. Its IUPAC name is [4-[[benzyl(methyl)amino]methyl]phenyl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone;hydrochloride.
| Compound Name | [4-[[benzyl(methyl)amino]methyl]phenyl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 53231551 |
| Molecular Formula | C30H37ClN2O2 |
| Molecular Weight | 493.09 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | [4-[[benzyl(methyl)amino]methyl]phenyl]-[4-(3-piperidin-1-ylpropoxy)phenyl]methanone;hydrochloride |
| SMILES | CN(Cc1ccccc1)Cc1ccc(C(=O)c2ccc(OCCCN3CCCCC3)cc2)cc1.Cl |
| InChI | InChI=1S/C30H36N2O2.ClH/c1-31(23-25-9-4-2-5-10-25)24-26-11-13-27(14-12-26)30(33)28-15-17-29(18-16-28)34-22-8-21-32-19-6-3-7-20-32;/h2,4-5,9-18H,3,6-8,19-24H2,1H3;1H |
| InChIKey | GHPCTLQLBNELRQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.09 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|