C36H48O9 — CID 53231603
1,2,4-trimethoxy-5-[(1S,2S,3R)-2-methyl-3-(2,4,5-trimethoxyphenyl)-1-[(E)-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]pentyl]benzene (PubChem CID 53231603) has the molecular formula C36H48O9 and a molecular weight of 624.77 g/mol. Its IUPAC name is 1,2,4-trimethoxy-5-[(1S,2S,3R)-2-methyl-3-(2,4,5-trimethoxyphenyl)-1-[(E)-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]pentyl]benzene.
| Compound Name | 1,2,4-trimethoxy-5-[(1S,2S,3R)-2-methyl-3-(2,4,5-trimethoxyphenyl)-1-[(E)-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]pentyl]benzene |
|---|---|
| PubChem CID | 53231603 |
| Molecular Formula | C36H48O9 |
| Molecular Weight | 624.77 g/mol |
| Exact Mass | 624.33 |
| IUPAC Name | 1,2,4-trimethoxy-5-[(1S,2S,3R)-2-methyl-3-(2,4,5-trimethoxyphenyl)-1-[(E)-1-(2,4,5-trimethoxyphenyl)prop-1-en-2-yl]pentyl]benzene |
| SMILES | CC[C@@H](c1cc(OC)c(OC)cc1OC)[C@H](C)[C@@H](/C(C)=C/c1cc(OC)c(OC)cc1OC)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C36H48O9/c1-13-24(25-16-31(41-8)34(44-11)19-28(25)38-5)22(3)36(26-17-32(42-9)35(45-12)20-29(26)39-6)21(2)14-23-15-30(40-7)33(43-10)18-27(23)37-4/h14-20,22,24,36H,13H2,1-12H3/b21-14+/t22-,24+,36+/m0/s1 |
| InChIKey | YHSWIYJJKPHZLA-KALZQYQPSA-N |
| XLogP | 7.78 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.77 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |