C27H27NO2 — CID 53231612
ethyl 2-ethyl-6-methyl-1-naphthalen-1-yl-4-phenyl-2H-pyridine-5-carboxylate (PubChem CID 53231612) has the molecular formula C27H27NO2 and a molecular weight of 397.52 g/mol. Its IUPAC name is ethyl 2-ethyl-6-methyl-1-naphthalen-1-yl-4-phenyl-2H-pyridine-5-carboxylate.
| Compound Name | ethyl 2-ethyl-6-methyl-1-naphthalen-1-yl-4-phenyl-2H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 53231612 |
| Molecular Formula | C27H27NO2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | ethyl 2-ethyl-6-methyl-1-naphthalen-1-yl-4-phenyl-2H-pyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2cccc3ccccc23)C(CC)C=C1c1ccccc1 |
| InChI | InChI=1S/C27H27NO2/c1-4-22-18-24(21-12-7-6-8-13-21)26(27(29)30-5-2)19(3)28(22)25-17-11-15-20-14-9-10-16-23(20)25/h6-18,22H,4-5H2,1-3H3 |
| InChIKey | YCWJMIGFTVVDOA-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |