C23H44O4Si — CID 53231662
[(4R,6S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-8-methoxytridec-1-en-4-yl] prop-2-enoate (PubChem CID 53231662) has the molecular formula C23H44O4Si and a molecular weight of 412.69 g/mol. Its IUPAC name is [(4R,6S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-8-methoxytridec-1-en-4-yl] prop-2-enoate.
| Compound Name | [(4R,6S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-8-methoxytridec-1-en-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 53231662 |
| Molecular Formula | C23H44O4Si |
| Molecular Weight | 412.69 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | [(4R,6S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-8-methoxytridec-1-en-4-yl] prop-2-enoate |
| SMILES | C=CC[C@H](C[C@H](C[C@H](CCCCC)OC)O[Si](C)(C)C(C)(C)C)OC(=O)C=C |
| InChI | InChI=1S/C23H44O4Si/c1-10-13-14-16-19(25-7)17-21(27-28(8,9)23(4,5)6)18-20(15-11-2)26-22(24)12-3/h11-12,19-21H,2-3,10,13-18H2,1,4-9H3/t19-,20+,21-/m0/s1 |
| InChIKey | KIZUWKCWYSRKMX-HBMCJLEFSA-N |
| XLogP | 6.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.69 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|