C18H23N5 — CID 53231787
4-[[[3-(azidomethyl)phenyl]methyl-methylamino]methyl]-N,N-dimethylaniline (PubChem CID 53231787) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is 4-[[[3-(azidomethyl)phenyl]methyl-methylamino]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[[3-(azidomethyl)phenyl]methyl-methylamino]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 53231787 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 4-[[[3-(azidomethyl)phenyl]methyl-methylamino]methyl]-N,N-dimethylaniline |
| SMILES | CN(Cc1ccc(N(C)C)cc1)Cc1cccc(CN=[N+]=[N-])c1 |
| InChI | InChI=1S/C18H23N5/c1-22(2)18-9-7-15(8-10-18)13-23(3)14-17-6-4-5-16(11-17)12-20-21-19/h4-11H,12-14H2,1-3H3 |
| InChIKey | KKKPWGFZXDDCGF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|