C17H13Cl2NO5 — CID 53231891
5,6-dichloro-2-(3,4,5-trimethoxyphenyl)isoindole-1,3-dione (PubChem CID 53231891) has the molecular formula C17H13Cl2NO5 and a molecular weight of 382.20 g/mol. Its IUPAC name is 5,6-dichloro-2-(3,4,5-trimethoxyphenyl)isoindole-1,3-dione.
| Compound Name | 5,6-dichloro-2-(3,4,5-trimethoxyphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 53231891 |
| Molecular Formula | C17H13Cl2NO5 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 5,6-dichloro-2-(3,4,5-trimethoxyphenyl)isoindole-1,3-dione |
| SMILES | COc1cc(N2C(=O)c3cc(Cl)c(Cl)cc3C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C17H13Cl2NO5/c1-23-13-4-8(5-14(24-2)15(13)25-3)20-16(21)9-6-11(18)12(19)7-10(9)17(20)22/h4-7H,1-3H3 |
| InChIKey | DRRPERJPOWCAOA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|