About 1-(furan-2-yl)-3-(1,2,4-triazol-1-yl)propan-1-ol
1-(furan-2-yl)-3-(1,2,4-triazol-1-yl)propan-1-ol (PubChem CID 53232023) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is 1-(furan-2-yl)-3-(1,2,4-triazol-1-yl)propan-1-ol.
Molecular Properties
| Compound Name | 1-(furan-2-yl)-3-(1,2,4-triazol-1-yl)propan-1-ol |
| PubChem CID | 53232023 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1-(furan-2-yl)-3-(1,2,4-triazol-1-yl)propan-1-ol |
| SMILES | OC(CCn1cncn1)c1ccco1 |
| InChI | InChI=1S/C9H11N3O2/c13-8(9-2-1-5-14-9)3-4-12-7-10-6-11-12/h1-2,5-8,13H,3-4H2 |
| InChIKey | ZMILLDSMMPVOLK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(furan-2-yl)-3-(1,2,4-triazol-1-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-2-yl)-3-(1,2,4-triazol-1-yl)propan-1-ol?
The IUPAC name of 1-(furan-2-yl)-3-(1,2,4-triazol-1-yl)propan-1-ol (CID 53232023) is 1-(furan-2-yl)-3-(1,2,4-triazol-1-yl)propan-1-ol.
What is the SMILES notation for 1-(furan-2-yl)-3-(1,2,4-triazol-1-yl)propan-1-ol?
The canonical SMILES for 1-(furan-2-yl)-3-(1,2,4-triazol-1-yl)propan-1-ol is OC(CCn1cncn1)c1ccco1.
What is the InChIKey of 1-(furan-2-yl)-3-(1,2,4-triazol-1-yl)propan-1-ol?
The InChIKey is ZMILLDSMMPVOLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c13-8(9-2-1-5-14-9)3-4-12-7-10-6-11-12/h1-2,5-8,13H,3-4H2.
What are the key properties of 1-(furan-2-yl)-3-(1,2,4-triazol-1-yl)propan-1-ol?
1-(furan-2-yl)-3-(1,2,4-triazol-1-yl)propan-1-ol has a molecular weight of 193.21 g/mol, XLogP of 0.99, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-2-yl)-3-(1,2,4-triazol-1-yl)propan-1-ol is sourced from PubChem (CID 53232023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).