C15H31Cl2N3O — CID 53232456
5-(3-chloro-2,2,4,4-tetramethyl-5-oxoimidazolidin-1-yl)pentyl-trimethylazanium chloride (PubChem CID 53232456) has the molecular formula C15H31Cl2N3O and a molecular weight of 340.34 g/mol. Its IUPAC name is 5-(3-chloro-2,2,4,4-tetramethyl-5-oxoimidazolidin-1-yl)pentyl-trimethylazanium chloride.
| Compound Name | 5-(3-chloro-2,2,4,4-tetramethyl-5-oxoimidazolidin-1-yl)pentyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 53232456 |
| Molecular Formula | C15H31Cl2N3O |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 5-(3-chloro-2,2,4,4-tetramethyl-5-oxoimidazolidin-1-yl)pentyl-trimethylazanium chloride |
| SMILES | CC1(C)C(=O)N(CCCCC[N+](C)(C)C)C(C)(C)N1Cl.[Cl-] |
| InChI | InChI=1S/C15H31ClN3O.ClH/c1-14(2)13(20)17(15(3,4)18(14)16)11-9-8-10-12-19(5,6)7;/h8-12H2,1-7H3;1H/q+1;/p-1 |
| InChIKey | GVNVIDWNERLUPI-UHFFFAOYSA-M |
| XLogP | -0.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|