C32H49FN4O4 — CID 53232611
(2S,4S,5S)-5-amino-6-[4-(5-fluoro-2-methylphenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-4-hydroxy-N-(5-hydroxy-2-adamantyl)-2-propan-2-ylhexanamide (PubChem CID 53232611) has the molecular formula C32H49FN4O4 and a molecular weight of 572.77 g/mol. Its IUPAC name is (2S,4S,5S)-5-amino-6-[4-(5-fluoro-2-methylphenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-4-hydroxy-N-(5-hydroxy-2-adamantyl)-2-propan-2-ylhexanamide.
| Compound Name | (2S,4S,5S)-5-amino-6-[4-(5-fluoro-2-methylphenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-4-hydroxy-N-(5-hydroxy-2-adamantyl)-2-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 53232611 |
| Molecular Formula | C32H49FN4O4 |
| Molecular Weight | 572.77 g/mol |
| Exact Mass | 572.37 |
| IUPAC Name | (2S,4S,5S)-5-amino-6-[4-(5-fluoro-2-methylphenyl)-2,2-dimethyl-5-oxopiperazin-1-yl]-4-hydroxy-N-(5-hydroxy-2-adamantyl)-2-propan-2-ylhexanamide |
| SMILES | Cc1ccc(F)cc1N1CC(C)(C)N(C[C@H](N)[C@@H](O)C[C@H](C(=O)NC2C3CC4CC2CC(O)(C4)C3)C(C)C)CC1=O |
| InChI | InChI=1S/C32H49FN4O4/c1-18(2)24(30(40)35-29-21-8-20-9-22(29)14-32(41,12-20)13-21)11-27(38)25(34)15-36-16-28(39)37(17-31(36,4)5)26-10-23(33)7-6-19(26)3/h6-7,10,18,20-22,24-25,27,29,38,41H,8-9,11-17,34H2,1-5H3,(H,35,40)/t20?,21?,22?,24-,25-,27-,29?,32?/m0/s1 |
| InChIKey | ZQSNFIDVGKQLCF-CKDHFPHXSA-N |
| XLogP | 2.97 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |