C32H40O12 — CID 53233198
[4,21-diacetyloxy-6-(furan-3-yl)-12,19-dihydroxy-15-methyl-3-oxo-9,17-dioxahexacyclo[13.3.3.01,14.02,11.05,10.08,10]henicosan-16-yl] 2-methylpropanoate (PubChem CID 53233198) has the molecular formula C32H40O12 and a molecular weight of 616.66 g/mol. Its IUPAC name is [4,21-diacetyloxy-6-(furan-3-yl)-12,19-dihydroxy-15-methyl-3-oxo-9,17-dioxahexacyclo[13.3.3.01,14.02,11.05,10.08,10]henicosan-16-yl] 2-methylpropanoate.
| Compound Name | [4,21-diacetyloxy-6-(furan-3-yl)-12,19-dihydroxy-15-methyl-3-oxo-9,17-dioxahexacyclo[13.3.3.01,14.02,11.05,10.08,10]henicosan-16-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 53233198 |
| Molecular Formula | C32H40O12 |
| Molecular Weight | 616.66 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | [4,21-diacetyloxy-6-(furan-3-yl)-12,19-dihydroxy-15-methyl-3-oxo-9,17-dioxahexacyclo[13.3.3.01,14.02,11.05,10.08,10]henicosan-16-yl] 2-methylpropanoate |
| SMILES | CC(=O)OC1C(=O)C2C(C(O)CC3C4(C)C(OC(C)=O)CC(O)C23COC4OC(=O)C(C)C)C23OC2CC(c2ccoc2)C13 |
| InChI | InChI=1S/C32H40O12/c1-13(2)28(38)43-29-30(5)19-9-18(35)24-25(31(19,12-40-29)20(36)10-21(30)41-14(3)33)26(37)27(42-15(4)34)23-17(16-6-7-39-11-16)8-22-32(23,24)44-22/h6-7,11,13,17-25,27,29,35-36H,8-10,12H2,1-5H3 |
| InChIKey | LCZMKAHELXTYJX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 171.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.66 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|